CAS 94262-62-1
:1-phenyl-2-(4-phenylpiperazin-1-yl)ethanol
Description:
1-Phenyl-2-(4-phenylpiperazin-1-yl)ethanol, with the CAS number 94262-62-1, is a chemical compound characterized by its complex structure, which includes a phenyl group and a piperazine moiety. This compound typically exhibits properties associated with both alcohols and amines due to the presence of the hydroxyl (-OH) group and the piperazine ring. It is often studied for its potential pharmacological activities, particularly in the context of neuropharmacology, as piperazine derivatives are known to interact with various neurotransmitter systems. The compound may display moderate solubility in polar solvents, influenced by the hydroxyl group, while its aromatic rings contribute to hydrophobic characteristics. Additionally, its molecular structure suggests potential for forming hydrogen bonds, which can affect its reactivity and interactions with biological targets. Overall, 1-phenyl-2-(4-phenylpiperazin-1-yl)ethanol is of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities would require further investigation.
Formula:C18H22N2O
InChI:InChI=1/C18H22N2O/c21-18(16-7-3-1-4-8-16)15-19-11-13-20(14-12-19)17-9-5-2-6-10-17/h1-10,18,21H,11-15H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.