CymitQuimica logo

CAS 94277-88-0

:

4,7-Methano-1H-indene-5-methanol, octahydro-, triester with boric acid (H3BO3)

Description:
4,7-Methano-1H-indene-5-methanol, octahydro-, triester with boric acid (CAS 94277-88-0) is a chemical compound characterized by its unique structure, which includes a methanoindene framework and boric acid moieties. This compound typically exhibits properties associated with esters, such as being relatively non-volatile and having low solubility in water, while being more soluble in organic solvents. The presence of boron in the structure may impart specific reactivity and coordination properties, making it of interest in various chemical applications, including potential uses in materials science and organic synthesis. The triester formation suggests that the compound may have enhanced stability and could act as a potential cross-linking agent or modifier in polymer chemistry. Additionally, the octahydro configuration indicates a saturated structure, which may contribute to its physical properties, such as melting point and boiling point. Overall, this compound's characteristics make it a subject of interest for further research in both industrial and academic settings.
Formula:C33H51BO3
InChI:InChI=1S/C33H51BO3/c1-4-25-19-10-22(31(13-19)28(25)7-1)16-35-34(36-17-23-11-20-14-32(23)29-8-2-5-26(20)29)37-18-24-12-21-15-33(24)30-9-3-6-27(21)30/h19-33H,1-18H2
InChI key:InChIKey=GBBUGBUDTMVMPN-UHFFFAOYSA-N
SMILES:C(OB(OCC1C2C3C(C(C1)C2)CCC3)OCC4C5C6C(C(C4)C5)CCC6)C7C8C9C(C(C8)C7)CCC9
Synonyms:
  • 4,7-Methano-1H-indene-5-methanol, octahydro-, triester with boric acid (H3BO3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.