
CAS 94278-23-6
:3-(Boronooxy)-2-hydroxypropyl octadecanoate
Description:
3-(Boronooxy)-2-hydroxypropyl octadecanoate, with the CAS number 94278-23-6, is a chemical compound that features a boronic acid derivative linked to a fatty acid ester. This compound typically exhibits characteristics associated with both boron-containing compounds and long-chain fatty acids. The presence of the boron moiety suggests potential applications in areas such as drug delivery, where boron can facilitate interactions with biological molecules. The hydroxypropyl group contributes to its hydrophilicity, enhancing solubility in aqueous environments, while the octadecanoate portion provides hydrophobic characteristics, making it suitable for forming emulsions or micelles. This dual nature allows for versatility in various applications, including in pharmaceuticals and materials science. Additionally, the compound may participate in specific chemical reactions, such as Suzuki coupling, due to the boron functionality, which can be advantageous in synthetic organic chemistry. Overall, 3-(Boronooxy)-2-hydroxypropyl octadecanoate is a compound of interest for its unique structural features and potential utility in diverse chemical and biological contexts.
Formula:C21H43BO6
InChI:InChI=1S/C21H43BO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)27-18-20(23)19-28-22(25)26/h20,23,25-26H,2-19H2,1H3
InChI key:InChIKey=QCJDCAOQAWDHMG-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCCCCCCCCCCC)=O)CC(COB(O)O)O
Synonyms:- 3-(Boronooxy)-2-hydroxypropyl octadecanoate
- Octadecanoic acid, 3-(boronooxy)-2-hydroxypropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
