CAS 94278-26-9
:Methyl 3-[(2-furanylmethyl)thio]propanoate
Description:
Methyl 3-[(2-furanylmethyl)thio]propanoate, with the CAS number 94278-26-9, is an organic compound characterized by its ester functional group, which is derived from propanoic acid and contains a methyl ester. The presence of a furan ring in its structure contributes to its unique chemical properties, including potential reactivity and stability under various conditions. This compound features a thioether linkage, which can influence its solubility and reactivity, particularly in nucleophilic substitution reactions. Methyl 3-[(2-furanylmethyl)thio]propanoate may exhibit biological activity, making it of interest in medicinal chemistry and natural product synthesis. Its molecular structure suggests it could participate in various chemical reactions, including those involving electrophiles and nucleophiles. Additionally, the compound's characteristics, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, this compound represents a versatile building block in organic synthesis and may have applications in pharmaceuticals or agrochemicals.
Formula:C9H12O3S
InChI:InChI=1S/C9H12O3S/c1-11-9(10)4-6-13-7-8-3-2-5-12-8/h2-3,5H,4,6-7H2,1H3
InChI key:InChIKey=MXXNUXUTQGTBGJ-UHFFFAOYSA-N
SMILES:C(SCCC(OC)=O)C1=CC=CO1
Synonyms:- Methyl 3-[(2-furanylmethyl)thio]propanoate
- Methyl 3-[(Furan-2-Ylmethyl)Sulfanyl]Propanoate
- Methyl furfuryl mercaptopropionate
- Propanoic acid, 3-((2-furanylmethyl)thio)-, methyl ester
- Methyl 3-(furfurylthio)propionate
- Methyl 3-furfurylthio propionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.