CAS 94278-70-3

2-(Bromomethyl)-1,3-dichloro-5-methoxybenzene

Description:

2-(Bromomethyl)-1,3-dichloro-5-methoxybenzene, with the CAS number 94278-70-3, is an organic compound characterized by its aromatic structure, which includes a methoxy group and multiple halogen substituents. This compound features a bromomethyl group, which enhances its reactivity, particularly in nucleophilic substitution reactions. The presence of two chlorine atoms and a methoxy group on the benzene ring contributes to its unique chemical properties, including potential applications in organic synthesis and medicinal chemistry. The dichloro substituents can influence the compound's electronic properties, making it a candidate for various chemical transformations. Additionally, the methoxy group can affect solubility and polarity, impacting its behavior in different solvents. Safety considerations should be taken into account due to the presence of halogens, which can pose environmental and health risks. Overall, this compound exemplifies the complexity and versatility of halogenated aromatic compounds in chemical research and applications.

Formula: C₈H₇BrCl₂O

InChI: InChI=1S/C8H7BrCl2O/c1-12-5-2-7(10)6(4-9)8(11)3-5/h2-3H,4H2,1H3

InChI key: InChIKey=KBAGYDQLZMGHMT-UHFFFAOYSA-N

SMILES: C(Br)C1=C(Cl)C=C(OC)C=C1Cl

Synonyms:

• Benzene, 2-(bromomethyl)-1,3-dichloro-5-methoxy-
• 2-Bromomethyl-1,3-dichloro-5-methoxybenzene
• 2-(Bromomethyl)-1,3-dichloro-5-methoxybenzene

2,6-Dichloro-4-methoxybenzyl bromide

CAS: 94278-70-3

2,6-Dichloro-4-methoxybenzyl bromide

Purity: ≥95%

Molecular weight: 269.95g/mol

Ref: 54-OR400697