CAS 942852-84-8

N-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine

Description:

N-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine, with the CAS number 942852-84-8, is a chemical compound characterized by its unique structure that includes a pyrazole ring and an ethyl group. This compound features a pyrazole moiety, which is a five-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The presence of the ethyl and dimethyl substituents enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The amine functional group suggests that it may engage in hydrogen bonding, making it a candidate for various chemical reactions and interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, the compound's unique structure and functional groups suggest potential applications in various fields, including drug development and agrochemicals.

Formula: C₁₀H₁₉N₃

InChI: InChI=1/C10H19N3/c1-5-11-7-10-8(3)12-13(6-2)9(10)4/h11H,5-7H2,1-4H3

SMILES: CCNCc1c(C)nn(CC)c1C

Synonyms:

• 1H-Pyrazole-4-methanamine, N,1-diethyl-3,5-dimethyl-
• N-[(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine