CAS 94291-69-7

1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-oxo-, chloride (1:1)

Description:

1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-oxo-, chloride (1:1), with the CAS number 94291-69-7, is a quaternary ammonium compound characterized by its trimethylated nitrogen atom and a carboxylic acid functional group. This compound typically exhibits properties associated with ionic substances, such as high solubility in polar solvents like water due to its ionic nature. The presence of the carboxylic acid group contributes to its potential as a zwitterionic species, which can influence its reactivity and interactions in biological systems. The chloride ion acts as a counterion, stabilizing the quaternary ammonium structure. This compound may be utilized in various applications, including as a surfactant, in pharmaceuticals, or in biochemical research, owing to its ability to interact with biological membranes and proteins. Its stability and solubility make it a candidate for further studies in drug delivery systems or as a biochemical reagent. However, specific safety and handling guidelines should be followed due to its ionic nature and potential biological activity.

Formula: C₇H₁₄NO₃·Cl

InChI: InChI=1S/C7H13NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h4-5H2,1-3H3;1H

InChI key: InChIKey=ARJSRFNLTQWYDA-UHFFFAOYSA-N

SMILES: C([N+](C)(C)C)C(CC(O)=O)=O.[Cl-]

Synonyms:

• 1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-oxo-, chloride
• 1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-oxo-, chloride (1:1)
• 3-Oxo-4-(Trimethylammonio)Butanoate
• 3-carboxy-N,N,N-trimethyl-2-oxopropan-1-aminium chloride
• Dehydrocarnitine hydrochloride

Carnitine Chloride Impurity 11

CAS: 94291-69-7

Formula: C₇H₁₄ClNO₃

Molecular weight: 195.64

Ref: 4Z-C-7232