CAS 942920-17-4

4-Chloro-5-methyl-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine

Description:

4-Chloro-5-methyl-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with a chlorine atom and a methyl group, as well as a tris(1-methylethyl)silyl group. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of novel pharmaceuticals or agrochemicals. The presence of the silyl group enhances its stability and solubility in organic solvents, making it useful in various chemical reactions. Additionally, the chlorine substituent may impart specific reactivity patterns, allowing for further functionalization. The compound's unique structure contributes to its properties, such as its electronic characteristics and steric effects, which can influence its behavior in chemical reactions. Overall, 4-Chloro-5-methyl-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine represents a versatile building block in synthetic chemistry.

Formula: C₁₇H₂₇ClN₂Si

InChI: InChI=1S/C17H27ClN2Si/c1-11(2)21(12(3)4,13(5)6)20-9-8-15-16(18)14(7)10-19-17(15)20/h8-13H,1-7H3

InChI key: InChIKey=WAROJOCZSCMOTE-UHFFFAOYSA-N

SMILES: [Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C(Cl)C(C)=CN2

Synonyms:

• 4-Chloro-5-methyl-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
• (4-Chloro-5-methylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane
• 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-methyl-1-[tris(1-methylethyl)silyl]-