CymitQuimica logo

CAS 942920-44-7

:

5-Bromo-2-methyl-4-(4-nitrophenyl)thiazole

Description:
5-Bromo-2-methyl-4-(4-nitrophenyl)thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom at the 5-position and a methyl group at the 2-position of the thiazole ring, contributing to its unique chemical properties. Additionally, it has a para-nitrophenyl group attached at the 4-position, which enhances its electron-withdrawing characteristics, making it potentially useful in various chemical reactions and applications. The presence of these functional groups suggests that the compound may exhibit biological activity, possibly serving as a lead compound in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and reactivity. Overall, 5-Bromo-2-methyl-4-(4-nitrophenyl)thiazole is of interest in both synthetic organic chemistry and medicinal chemistry due to its diverse functional groups and potential applications.
Formula:C10H7BrN2O2S
InChI:InChI=1S/C10H7BrN2O2S/c1-6-12-9(10(11)16-6)7-2-4-8(5-3-7)13(14)15/h2-5H,1H3
InChI key:InChIKey=LMJUXYQCUREBHV-UHFFFAOYSA-N
SMILES:BrC1=C(N=C(C)S1)C2=CC=C(N(=O)=O)C=C2
Synonyms:
  • 5-Bromo-2-methyl-4-(4-nitrophenyl)thiazole
  • Thiazole, 5-bromo-2-methyl-4-(4-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.