CAS 942920-50-5

4-bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine

Description:

4-Bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 4 and 6 positions, respectively, enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, making it suitable for various synthetic applications. Its structure allows for potential interactions with biological targets, which has garnered interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 942920-50-5, is a unique identifier that facilitates its identification in chemical databases. Overall, 4-bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine is notable for its structural complexity and potential utility in research and development within organic and medicinal chemistry.

Formula: C₇H₄BrClN₂

InChI: InChI=1/C7H4BrClN2/c8-5-3-6(9)11-7-4(5)1-2-10-7/h1-3H,(H,10,11)

SMILES: c1c[nH]c2c1c(cc(Cl)n2)Br

Synonyms:

• 4-Brom-6-chlor-1H-pyrrolo[2,3-b]pyridin

4-Bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine

CAS: 942920-50-5

Formula: C₇H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 231.4771

Ref: IN-DA006C7S

4-Bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine

CAS: 942920-50-5

4-Bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine

Purity: 95%

Molecular weight: 231.48g/mol

Ref: 54-OR84150

4-Bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine

CAS: 942920-50-5

Formula: C₇H₄BrClN₂

Purity: 95%

Molecular weight: 231.48

Ref: 10-F235329

4-Bromo-6-chloro-1H-pyrrolo[2,3-B]pyridine

Controlled Product

CAS: 942920-50-5

Formula: C₇H₄BrClN₂

Color and Shape: Neat

Molecular weight: 231.477

Ref: TR-B545715