CymitQuimica logo

CAS 942922-07-8

:

2-(4-Methylpiperazino)pyrimidine-5-boronic acid pinacol ester

Description:
2-(4-Methylpiperazino)pyrimidine-5-boronic acid pinacol ester is a chemical compound characterized by its boronic acid functionality, which is often utilized in medicinal chemistry and organic synthesis. This compound features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms, and a piperazine moiety, contributing to its potential biological activity. The presence of the pinacol ester group enhances its stability and solubility, making it suitable for various applications, including drug development and as a building block in organic synthesis. The boronic acid group allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds. Additionally, the methyl substitution on the piperazine ring may influence the compound's pharmacokinetic properties, such as lipophilicity and receptor binding affinity. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, showcasing the importance of structural features in determining chemical reactivity and biological activity.
Formula:C15H25BN4O2
InChI:InChI=1S/C15H25BN4O2/c1-14(2)15(3,4)22-16(21-14)12-10-17-13(18-11-12)20-8-6-19(5)7-9-20/h10-11H,6-9H2,1-5H3
InChI key:LGIDGOSYDQTQDO-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCN(CC3)C
Synonyms:
  • 2-(4-Methylpiperazin-1-yl)pyrimidine-5-boronic acid pinacol ester
Found 3 products.