CAS 942947-93-5

2-(4-{6-chloro-2-[4-(dimethylamino)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl}piperazin-1-yl)-N-1,3-thiazol-2-ylacetamide

Description:

The chemical substance known as 2-(4-{6-chloro-2-[4-(dimethylamino)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl}piperazin-1-yl)-N-1,3-thiazol-2-ylacetamide, with the CAS number 942947-93-5, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a thiazole moiety, which is known for its biological activity, and an imidazopyridine core that contributes to its potential pharmacological properties. The presence of a piperazine ring enhances its solubility and bioavailability, while the dimethylamino group may influence its interaction with biological targets. Additionally, the chlorine substituent can affect the compound's reactivity and stability. This compound is likely to exhibit significant activity in medicinal chemistry, particularly in the development of therapeutic agents, due to its intricate structure that allows for diverse interactions with biological systems. Its specific characteristics, including solubility, melting point, and spectral properties, would typically be determined through experimental methods and are essential for understanding its behavior in various applications.

Formula: C₂₃H₂₅ClN₈OS

InChI: InChI=1/C23H25ClN8OS/c1-30(2)16-5-3-15(4-6-16)21-28-19-20(17(24)13-26-22(19)29-21)32-10-8-31(9-11-32)14-18(33)27-23-25-7-12-34-23/h3-7,12-13H,8-11,14H2,1-2H3,(H,25,27,33)(H,26,28,29)

SMILES: CN(C)c1ccc(cc1)c1[nH]c2c(c(cnc2n1)Cl)N1CCN(CC1)CC(=Nc1nccs1)O

Synonyms:

• Cct129202

1-piperazineacetamide, 4-[6-chloro-2-[4-(dimethylamino)phenyl]-3H-imidazo[4,5-b]pyridin-7-yl]-N-2-thiazolyl-

CAS: 942947-93-5

Formula: C₂₃H₂₅ClN₈OS

Purity: 98%

Molecular weight: 497.0156

Ref: IN-DA01DPZ0

CCT129202

CAS: 942947-93-5

CCT129202

Purity: ≥98%

Molecular weight: 497.02g/mol

Ref: 54-BUP09519

CCT129202

CAS: 942947-93-5

CCT129202 is an ATP-competitive pan-Aurora inhibitor for Aurora A, Aurora B and Aurora C with IC50 of 0.042 μM, 0.198 μM and 0.227 μM, respectively.

Formula: C₂₃H₂₅ClN₈OS

Purity: 98.14%

Color and Shape: Solid

Molecular weight: 497.02

Ref: TM-T6435