CAS 942947-95-7

5-Bromo-4-chloro-3-nitro-2-pyridinamine

Description:

5-Bromo-4-chloro-3-nitro-2-pyridinamine is an organic compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with various functional groups. The presence of bromine and chlorine atoms, along with a nitro group and an amino group, contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The nitro group is known for its electron-withdrawing properties, influencing the compound's reactivity and stability. Additionally, the halogen substituents can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The compound's unique combination of substituents may also impart specific biological activities, making it of interest in pharmaceutical research. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated and nitro compounds. Overall, 5-Bromo-4-chloro-3-nitro-2-pyridinamine is a versatile compound with significant implications in chemical synthesis and biological applications.

Formula: C₅H₃BrClN₃O₂

InChI: InChI=1S/C5H3BrClN3O2/c6-2-1-9-5(8)4(3(2)7)10(11)12/h1H,(H2,8,9)

InChI key: InChIKey=BLGCPXIDEMLKMS-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(Cl)=C(Br)C=NC1N

Synonyms:

• 2-Pyridinamine, 5-bromo-4-chloro-3-nitro-
• 5-Bromo-4-Chloro-3-Nitropyridin-2-Amine
• 5-Bromo-4-chloro-3-nitro-2-pyridinamine
• 2-Amino-5-bromo-4-chloro-3-nitropyridine

2-Amino-5-bromo-4-chloro-3-nitropyridine

CAS: 942947-95-7

Formula: C₅H₃BrClN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 252.4532

Ref: IN-DA005Z81

2-Amino-5-bromo-4-chloro-3-nitropyridine

CAS: 942947-95-7

2-Amino-5-bromo-4-chloro-3-nitropyridine

Purity: 97%

Molecular weight: 252.45g/mol

Ref: 54-OR345460

2-Amino-5-bromo-4-chloro-3-nitropyridine

CAS: 942947-95-7

Formula: C₅H₃BrClN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 252.45

Ref: 10-F078134