CAS 943107-35-5

5-methyl-1-propyl-1H-pyrazol-3-amine

Description:

5-Methyl-1-propyl-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a propyl group attached to the pyrazole ring, specifically at the 5 and 1 positions, respectively. The presence of the amino group (-NH2) at the 3 position contributes to its reactivity and potential applications in various chemical reactions. The molecular structure suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Additionally, the presence of alkyl groups can influence its solubility and lipophilicity, making it potentially useful in medicinal chemistry or as a building block in organic synthesis. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and may vary based on purity and environmental conditions.

Formula: C₇H₁₃N₃

InChI: InChI=1/C7H13N3/c1-3-4-10-6(2)5-7(8)9-10/h5H,3-4H2,1-2H3,(H2,8,9)

SMILES: CCCn1c(C)cc(=N)[nH]1

Synonyms:

• 1H-Pyrazol-3-amine, 5-methyl-1-propyl-