CAS 943133-81-1

L-Proline, glycyl-4-(benzoylamino)-, hydrochloride (1:1), (4R)-

Description:

L-Proline, glycyl-4-(benzoylamino)-, hydrochloride (1:1), (4R)- is a synthetic compound that belongs to the class of amino acids and peptides. It features a proline backbone, which is a cyclic amino acid known for its role in protein structure and stability. The presence of the benzoylamino group indicates that it has been modified to enhance its biological activity or solubility. As a hydrochloride salt, it is typically more soluble in water, making it suitable for various applications in biochemical research and pharmaceutical formulations. The (4R)- designation refers to the specific stereochemistry of the proline moiety, which is crucial for its biological function and interaction with other biomolecules. This compound may exhibit properties such as being a potential inhibitor or modulator in enzymatic reactions, and its structure suggests it could interact with specific receptors or enzymes in biological systems. Overall, its unique characteristics make it a valuable compound for studies in medicinal chemistry and drug development.

Formula: C₁₄H₁₇N₃O₄·ClH

InChI: InChI=1S/C14H17N3O4.ClH/c15-7-12(18)17-8-10(6-11(17)14(20)21)16-13(19)9-4-2-1-3-5-9;/h1-5,10-11H,6-8,15H2,(H,16,19)(H,20,21);1H/t10-,11+;/m1./s1

InChI key: InChIKey=AHXPMNACLWKFRQ-DHXVBOOMSA-N

SMILES: C(CN)(=O)N1[C@H](C(O)=O)C[C@@H](NC(=O)C2=CC=CC=C2)C1.Cl

Synonyms:

• L-Proline, glycyl-4-(benzoylamino)-, hydrochloride (1:1), (4R)-
• Danegaptide hydrochloride

GAP-134(Hydrochloride)

CAS: 943133-81-1

Formula: C₁₄H₁₈ClN₃O₄

Purity: 99%

Color and Shape: Solid

Molecular weight: 327.7634

Ref: IN-DA01DOT2

(2S,4R)-4-Benzamido-1-glycylpyrrolidine-2-carboxylic acid hydrochloride

CAS: 943133-81-1

(2S,4R)-4-Benzamido-1-glycylpyrrolidine-2-carboxylic acid hydrochloride

Purity: 99%

Molecular weight: 327.77g/mol

Ref: 54-OR1074774

Danegaptide Hydrochloride

CAS: 943133-81-1

Danegaptide Hydrochloride (GAP-134 (Hydrochloride)) (GAP-134 Hydrochloride) is a selective modifier of the gap junction protein.

Formula: C₁₄H₁₈ClN₃O₄

Purity: 99.55%

Color and Shape: Solid

Molecular weight: 327.76

Ref: TM-T19335

Danegaptide Hydrochloride

CAS: 943133-81-1

Danegaptide hydrochloride is a is a potent, selective and orally active gap junction modifier with an anti-arrhythmic effect

Formula: C₁₄H₁₈ClN₃O₄

Purity: Min. 95%

Molecular weight: 327.76 g/mol

Ref: 3D-TMB13381