
CAS 94317-67-6
:N-Cyclohexylphosphorothioic triamide
Description:
N-Cyclohexylphosphorothioic triamide is a chemical compound characterized by its phosphorus-containing structure, which includes a cyclohexyl group and three amide functionalities. This compound is typically classified as a phosphorothioate, indicating the presence of a phosphorus atom bonded to sulfur and nitrogen atoms. It exhibits properties typical of organophosphorus compounds, including potential applications in agriculture as a pesticide or herbicide due to its ability to interact with biological systems. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the triamide structure suggests that it may participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. Safety and handling precautions are essential, as compounds in this class can exhibit toxicity to non-target organisms. Overall, N-Cyclohexylphosphorothioic triamide represents a unique class of chemicals with specific applications and safety considerations in various fields, particularly in agrochemistry.
Formula:C6H16N3PS
InChI:InChI=1S/C6H16N3PS/c7-10(8,11)9-6-4-2-1-3-5-6/h6H,1-5H2,(H5,7,8,9,11)
InChI key:InChIKey=WOPHQTWCQNDMGH-UHFFFAOYSA-N
SMILES:N(P(N)(N)=S)C1CCCCC1
Synonyms:- Phosphorothioic triamide, N-cyclohexyl-
- N-Cyclohexylphosphorothioic triamide
- Phosphorothioic triamide, cyclohexyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.