CAS 94318-71-5
:2-chloro-N-propyl-propanamide
Description:
2-Chloro-N-propyl-propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the second carbon position of the propyl chain contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate polarity due to the amide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The molecular structure suggests that it may have a relatively low volatility and a higher boiling point compared to non-polar compounds of similar molecular weight. Additionally, the presence of the chlorine substituent can enhance its biological activity, making it of interest in pharmaceutical chemistry. Safety data sheets would indicate that it should be handled with care, as halogenated compounds can pose health risks. Overall, 2-chloro-N-propyl-propanamide is a versatile compound with potential applications in synthesis and medicinal chemistry, though specific handling and safety protocols should always be followed.
Formula:C6H12ClNO
InChI:InChI=1/C6H12ClNO/c1-3-4-8-6(9)5(2)7/h5H,3-4H2,1-2H3,(H,8,9)
SMILES:CCCN=C(C(C)Cl)O
Synonyms:- 2-chloro-N-propylpropanamide
- propanamide, 2-chloro-N-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.