CAS 94319-87-6

N-(2-Aminoethyl)-3,4-dichlorobenzamide

Description:

N-(2-Aminoethyl)-3,4-dichlorobenzamide, with the CAS number 94319-87-6, is a chemical compound characterized by its amide functional group and the presence of dichlorine substituents on a benzene ring. This compound features an aminoethyl side chain, which contributes to its potential biological activity. The dichlorobenzamide structure suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The presence of chlorine atoms typically enhances lipophilicity and can influence the compound's reactivity and binding properties. N-(2-Aminoethyl)-3,4-dichlorobenzamide may be synthesized through various organic reactions, and its properties can be influenced by factors such as pH and solvent. As with many amides, it may exhibit moderate solubility in polar solvents. Safety and handling precautions should be observed, as with any chemical compound, particularly those with potential biological activity. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications in research or industry.

Formula: C₉H₁₀Cl₂N₂O

InChI: InChI=1S/C9H10Cl2N2O/c10-7-2-1-6(5-8(7)11)9(14)13-4-3-12/h1-2,5H,3-4,12H2,(H,13,14)

InChI key: InChIKey=BVSYYNFOBNEAHX-UHFFFAOYSA-N

SMILES: C(NCCN)(=O)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• N-(2-Aminoethyl)-3,4-dichlorobenzamide
• Benzamide, N-(2-aminoethyl)-3,4-dichloro-