
CAS 94319-94-5
:N-(2-Aminoethyl)-4-(trifluoromethyl)benzamide
Description:
N-(2-Aminoethyl)-4-(trifluoromethyl)benzamide, with the CAS number 94319-94-5, is an organic compound characterized by its amide functional group and the presence of a trifluoromethyl group, which significantly influences its chemical properties. This compound features a benzene ring substituted with a trifluoromethyl group at the para position and an aminoethyl side chain that contributes to its basicity and potential for hydrogen bonding. The trifluoromethyl group enhances the lipophilicity and stability of the molecule, making it of interest in medicinal chemistry and material science. The aminoethyl moiety can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, potentially serving as a scaffold for drug development. Its solubility and reactivity can vary depending on the solvent and conditions, making it a versatile compound in synthetic organic chemistry. Overall, N-(2-Aminoethyl)-4-(trifluoromethyl)benzamide is notable for its unique structural features and potential applications in various fields.
Formula:C10H11F3N2O
InChI:InChI=1S/C10H11F3N2O/c11-10(12,13)8-3-1-7(2-4-8)9(16)15-6-5-14/h1-4H,5-6,14H2,(H,15,16)
InChI key:InChIKey=JPRXDQLABXRTTL-UHFFFAOYSA-N
SMILES:C(NCCN)(=O)C1=CC=C(C(F)(F)F)C=C1
Synonyms:- N-(2-Aminoethyl)-4-(trifluoromethyl)benzamide
- Benzamide, N-(2-aminoethyl)-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.