CAS 943247-49-2
:5-allyl-2-fluoro-benzonitrile
Description:
5-Allyl-2-fluoro-benzonitrile is an organic compound characterized by its unique structure, which includes a benzene ring substituted with both an allyl group and a fluorine atom, as well as a nitrile functional group. The presence of the allyl group introduces a degree of unsaturation and potential reactivity, while the fluorine atom can influence the compound's polarity and reactivity due to its electronegativity. The nitrile group contributes to the compound's overall stability and can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit interesting properties such as solubility in organic solvents, and its reactivity can be influenced by the electronic effects of the fluorine and the steric effects of the allyl group. Additionally, the compound's structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many fluorinated compounds, it may also possess unique physical and chemical properties that warrant further investigation.
Formula:C10H8FN
InChI:InChI=1/C10H8FN/c1-2-3-8-4-5-10(11)9(6-8)7-12/h2,4-6H,1,3H2
SMILES:C=CCc1ccc(c(c1)C#N)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.