CymitQuimica logo

CAS 943323-63-5

:

4-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine

Description:
4-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a bromine atom and a nitro group at specific positions on the pyrrolo ring enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, making it suitable for various synthetic reactions. Its molecular structure allows for potential interactions with biological targets, which is of interest in drug development. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing nature of the nitro group and the halogen substituent, which may affect its electronic properties and reactivity in electrophilic or nucleophilic reactions. Overall, 4-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine is a valuable compound for research in organic synthesis and pharmacology.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-4-1-2-9-7-6(4)5(3-10-7)11(12)13/h1-3H,(H,9,10)
InChI key:InChIKey=BEPFGDZUAZYOHN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=NC=CC2Br
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4-bromo-3-nitro-
  • 4-Brom-3-nitro-1H-pyrrolo[2,3-b]pyridin
  • 4-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.