CymitQuimica logo

CAS 94333-55-8

:

1,30-Bis[2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl] 5,7,7,24,24,26-hexamethyl-10,21-dioxo-11,14,17,20-tetraoxa-2,9,22,29-tetraazatriacontanedioate

Description:
The chemical substance known as "1,30-Bis[2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl] 5,7,7,24,24,26-hexamethyl-10,21-dioxo-11,14,17,20-tetraoxa-2,9,22,29-tetraazatriacontanedioate," with the CAS number 94333-55-8, is a complex organic compound characterized by its extensive molecular structure, which includes multiple functional groups such as ester and ether linkages. This compound features a long carbon chain with several methyl groups, contributing to its hydrophobic characteristics. The presence of dioxo and tetraoxa groups indicates potential reactivity and stability under various conditions. Its structure suggests potential applications in fields such as materials science, pharmaceuticals, or as a polymer additive, where its unique properties could enhance performance. The specific arrangement of atoms and functional groups may also influence its solubility, melting point, and reactivity, making it a subject of interest for further research and application development. However, detailed studies would be necessary to fully understand its behavior and potential uses in various chemical contexts.
Formula:C40H70N4O14
InChI:InChI=1S/C40H70N4O14/c1-29(2)33(45)53-21-23-57-35(47)41-13-11-31(5)25-39(7,8)27-43-37(49)55-19-17-51-15-16-52-18-20-56-38(50)44-28-40(9,10)26-32(6)12-14-42-36(48)58-24-22-54-34(46)30(3)4/h31-32H,1,3,11-28H2,2,4-10H3,(H,41,47)(H,42,48)(H,43,49)(H,44,50)
InChI key:InChIKey=SSYMTHGEWTYMCS-UHFFFAOYSA-N
SMILES:C(C(CNC(OCCOCCOCCOC(NCC(CC(CCNC(OCCOC(C(C)=C)=O)=O)C)(C)C)=O)=O)(C)C)C(CCNC(OCCOC(C(C)=C)=O)=O)C
Synonyms:
  • 1,30-Bis[2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl] 5,7,7,24,24,26-hexamethyl-10,21-dioxo-11,14,17,20-tetraoxa-2,9,22,29-tetraazatriacontanedioate
  • 11,14,17,20-Tetraoxa-2,9,22,29-tetraazatriacontanedioic acid, 5,7,7,24,24,26-hexamethyl-10,21-dioxo-, 1,30-bis[2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl] ester
  • 11,14,17,20-Tetraoxa-2,9,22,29-tetraazatriacontanedioic acid, 5,7,7,24,24,26-hexamethyl-10,21-dioxo-, bis[2-[(2-methyl-1-oxo-2-propenyl)oxy]ethyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.