CAS 94336-05-7
:1-(2-chlorobenzyl)-3-[4-(1,1-dichloro-2,2-difluoroethoxy)phenyl]urea
Description:
1-(2-Chlorobenzyl)-3-[4-(1,1-dichloro-2,2-difluoroethoxy)phenyl]urea, with the CAS number 94336-05-7, is a synthetic organic compound characterized by its urea functional group, which is linked to a chlorobenzyl moiety and a phenyl group substituted with a dichloro-difluoroethoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many urea derivatives. Its structure suggests potential biological activity, possibly as a herbicide or pesticide, due to the presence of halogen substituents that can enhance lipophilicity and biological interactions. The presence of chlorine and fluorine atoms may also contribute to its stability and reactivity. As with many synthetic chemicals, safety data should be consulted to understand its toxicity, environmental impact, and handling precautions. Overall, this compound represents a class of chemicals that may have applications in agricultural chemistry or related fields.
Formula:C16H13Cl3F2N2O2
InChI:InChI=1/C16H13Cl3F2N2O2/c17-13-4-2-1-3-10(13)9-22-15(24)23-11-5-7-12(8-6-11)25-16(18,19)14(20)21/h1-8,14H,9H2,(H2,22,23,24)
SMILES:c1ccc(c(c1)CN=C(Nc1ccc(cc1)OC(C(F)F)(Cl)Cl)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.