CymitQuimica logo

CAS 943438-02-6

:

3-Thietanamine, 3-methyl-, 1,1-dioxide

Description:
3-Thietanamine, 3-methyl-, 1,1-dioxide, with the CAS number 943438-02-6, is a chemical compound characterized by its unique thietane ring structure, which is a four-membered cyclic compound containing a sulfur atom. This compound features a methyl group at the 3-position of the thietanamine, contributing to its overall molecular structure and properties. The presence of the 1,1-dioxide functional group indicates that there are two oxygen atoms double-bonded to the sulfur atom, which can influence the compound's reactivity and polarity. Generally, compounds with thietane rings exhibit interesting chemical behavior, including potential applications in organic synthesis and medicinal chemistry. The presence of the amine functional group suggests that it may participate in hydrogen bonding, affecting its solubility and interaction with other molecules. As with many sulfur-containing compounds, it may also exhibit unique odor characteristics. However, specific physical and chemical properties such as boiling point, melting point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C4H9NO2S
InChI:InChI=1S/C4H9NO2S/c1-4(5)2-8(6,7)3-4/h2-3,5H2,1H3
InChI key:InChIKey=PMKPNGBRDFIFNX-UHFFFAOYSA-N
SMILES:CC1(N)CS(=O)(=O)C1
Synonyms:
  • 3-Amino-3-methylthietane-1,1-dioxide
  • 3-Thietanamine, 3-methyl-, 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.