CymitQuimica logo

CAS 94349-40-3

:

3,6,9,12,15,18,21,24-Octaoxahexacosan-1-ol, 26-(4-nonylphenoxy)-, compd. with iodine (1:?)

Description:
3,6,9,12,15,18,21,24-Octaoxahexacosan-1-ol, 26-(4-nonylphenoxy)-, compd. with iodine (CAS 94349-40-3) is a complex organic compound characterized by its long-chain structure, which includes multiple ether linkages due to the presence of eight oxygen atoms in its backbone. This compound features a nonylphenoxy group, which contributes to its hydrophobic properties, making it potentially useful in applications such as surfactants or emulsifiers. The presence of iodine suggests that this compound may have applications in medicinal chemistry or as a reagent in organic synthesis, as iodine can serve as a halogenating agent or a catalyst in various reactions. The molecular structure indicates that it may exhibit unique solubility characteristics, potentially being soluble in organic solvents while having limited solubility in water. Additionally, the presence of multiple functional groups may impart specific reactivity or interaction capabilities, making it of interest in various chemical and industrial applications. Overall, this compound's unique structural features and functional groups suggest a range of potential uses in both research and industry.
Formula:C33H60O10·xI2
InChI:InChI=1S/C33H60O10.I2/c1-2-3-4-5-6-7-8-9-32-10-12-33(13-11-32)43-31-30-42-29-28-41-27-26-40-25-24-39-23-22-38-21-20-37-19-18-36-17-16-35-15-14-34;1-2/h10-13,34H,2-9,14-31H2,1H3;
InChI key:InChIKey=JZRWBNHLJVOEAT-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCOCCOCCOCCO)C1=CC=C(CCCCCCCCC)C=C1.II
Synonyms:
  • 3,6,9,12,15,18,21,24-Octaoxahexacosan-1-ol, 26-(4-nonylphenoxy)-, compd. with iodine (1:?)
  • Iodine, compd. with 26-(4-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol
  • 3,6,9,12,15,18,21,24-Octaoxahexacosan-1-ol, 26-(4-nonylphenoxy)-, compd. with iodine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.