
CAS 943516-53-8
:6,6-Dimethyl-3-(phenylmethyl)-3-azabicyclo[3.1.0]hexane-2,4-dione
Description:
6,6-Dimethyl-3-(phenylmethyl)-3-azabicyclo[3.1.0]hexane-2,4-dione is a bicyclic compound characterized by its unique structural framework, which includes a bicyclo[3.1.0]hexane core with a nitrogen atom incorporated into the ring system. The presence of two methyl groups at the 6-position and a phenylmethyl substituent at the 3-position contributes to its complex molecular structure and potential biological activity. The compound features two carbonyl groups, which are characteristic of diketones, located at the 2 and 4 positions, enhancing its reactivity and potential for forming various derivatives. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 943516-53-8, allows for easy identification and retrieval of information in chemical databases. Overall, the unique combination of bicyclic structure, functional groups, and substituents makes this compound a valuable candidate for further research in organic synthesis and drug development.
Formula:C14H15NO2
InChI:InChI=1S/C14H15NO2/c1-14(2)10-11(14)13(17)15(12(10)16)8-9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3
InChI key:InChIKey=YWZCNFAKNHKAHM-UHFFFAOYSA-N
SMILES:CC1(C)C2C1C(=O)N(CC3=CC=CC=C3)C2=O
Synonyms:- 3-Benzyl-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione
- 6,6-Dimethyl-3-(phenylmethyl)-3-azabicyclo[3.1.0]hexane-2,4-dione
- 3-Azabicyclo[3.1.0]hexane-2,4-dione, 6,6-dimethyl-3-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.