CAS 943516-56-1

6,6-Dimethyl-3-azabicyclo[3.1.0]hex-2-ene

Description:

6,6-Dimethyl-3-azabicyclo[3.1.0]hex-2-ene is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom integrated into the ring system. This compound features two methyl groups attached to the carbon framework, specifically at the 6-position, contributing to its steric and electronic properties. The azabicyclic structure indicates the presence of a nitrogen atom within a bicyclic framework, which can influence its reactivity and interactions with other chemical species. The compound is likely to exhibit basic properties due to the nitrogen atom, which can participate in hydrogen bonding and coordination with metal ions. Additionally, the bicyclic nature may impart rigidity to the molecule, affecting its conformational dynamics and potential applications in medicinal chemistry or as a synthetic intermediate. Overall, 6,6-Dimethyl-3-azabicyclo[3.1.0]hex-2-ene represents a structurally interesting compound with potential implications in various chemical research fields.

Formula: C₇H₁₁N

InChI: InChI=1S/C7H11N/c1-7(2)5-3-8-4-6(5)7/h3,5-6H,4H2,1-2H3

InChI key: InChIKey=LJCZYRLHQVSPNR-UHFFFAOYSA-N

SMILES: CC1(C)C2C1C=NC2

Synonyms:

• 6,6-Dimethyl-3-azabicyclo[3.1.0]hex-3-ene
• 3-Azabicyclo[3.1.0]hex-2-ene, 6,6-dimethyl-
• 6,6-Dimethyl-3-azabicyclo[3.1.0]hex-2-ene

Boceprevir Impurity 1

CAS: 943516-56-1

Formula: C₇H₁₁N

Molecular weight: 109.17

Ref: 4Z-B-534