CAS 943587-27-7

2,3-Dihydro-5-benzofuranacetaldehyde

Description:

2,3-Dihydro-5-benzofuranacetaldehyde is an organic compound characterized by its unique structure, which includes a benzofuran moiety and an aldehyde functional group. This compound features a bicyclic structure that contributes to its chemical properties, including its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack, which can be leveraged in various chemical reactions. Additionally, the benzofuran ring system may impart certain biological activities, making it of interest in medicinal chemistry. The compound's solubility is generally influenced by the polarity of its functional groups, and it may exhibit moderate solubility in organic solvents. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if inhaled or ingested. Overall, 2,3-Dihydro-5-benzofuranacetaldehyde is a compound of interest for further research and potential applications in various fields.

Formula: C₁₀H₁₀O₂

InChI: InChI=1S/C10H10O2/c11-5-3-8-1-2-10-9(7-8)4-6-12-10/h1-2,5,7H,3-4,6H2

InChI key: InChIKey=NTJRMUOGVCOSOO-UHFFFAOYSA-N

SMILES: C(C=O)C=1C=C2C(=CC1)OCC2

Synonyms:

• 2-(2,3-Dihydro-1-benzofuran-5-yl)acetaldehyde
• 2-(2,3-Dihydrobenzofuran-5-yl)acetaldehyde
• 5-Benzofuranacetaldehyde, 2,3-dihydro-
• 2,3-Dihydro-5-benzofuranacetaldehyde