
CAS 943589-83-1
:7-Bromo-1,4-dioxaspiro[4.5]decan-8-one
Description:
7-Bromo-1,4-dioxaspiro[4.5]decan-8-one is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane moiety and a bromine substituent. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations. The compound features a spiro linkage, which contributes to its three-dimensional conformation and can influence its physical and chemical properties, such as solubility and stability. The dioxaspiro structure may also impart interesting biological activity, making it of interest in medicinal chemistry. Additionally, the compound's molecular framework suggests potential applications in organic synthesis and material science. Its CAS number, 943589-83-1, allows for easy identification in chemical databases and literature. Overall, 7-Bromo-1,4-dioxaspiro[4.5]decan-8-one exemplifies the complexity and diversity of organic compounds, with implications for both research and practical applications in various fields.
Formula:C8H11BrO3
InChI:InChI=1S/C8H11BrO3/c9-6-5-8(2-1-7(6)10)11-3-4-12-8/h6H,1-5H2
InChI key:InChIKey=KEYNACNTEZWDJL-UHFFFAOYSA-N
SMILES:BrC1CC2(CCC1=O)OCCO2
Synonyms:- 7-Bromo-1,4-dioxaspiro[4.5]decan-8-one
- 1,4-Dioxaspiro[4.5]decan-8-one, 7-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.