CAS 94359-48-5
:L-threonyl-L-lysyl-N-[(2S)-5-[(diaminomethylidene)amino]-2-{[2-(hexadecanoylamino)ethyl]amino}pentanoyl]-L-prolinamide
Description:
L-threonyl-L-lysyl-N-[(2S)-5-[(diaminomethylidene)amino]-2-{[2-(hexadecanoylamino)ethyl]amino}pentanoyl]-L-prolinamide, with the CAS number 94359-48-5, is a synthetic peptide that exhibits characteristics typical of complex amino acid sequences. This compound features a combination of L-threonine and L-lysine residues, which contribute to its structural and functional properties. The presence of a diaminomethylidene group suggests potential for enhanced reactivity and interaction with biological targets. Additionally, the hexadecanoylamino group indicates a fatty acid chain, which may enhance membrane permeability and influence its biological activity. Peptides like this one are often studied for their potential applications in drug development, particularly in targeting specific biological pathways or enhancing therapeutic efficacy. The intricate structure implies that it may exhibit unique solubility and stability characteristics, making it suitable for various biochemical applications. Overall, this compound represents a fascinating example of peptide chemistry with potential implications in medicinal chemistry and biochemistry.
Formula:C39H76N10O6
InChI:InChI=1/C39H76N10O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-23-33(51)45-27-26-44-30(21-18-25-46-39(42)43)35(52)48-36(53)32-22-19-28-49(32)38(55)31(20-16-17-24-40)47-37(54)34(41)29(2)50/h29-32,34,44,50H,3-28,40-41H2,1-2H3,(H,45,51)(H,47,54)(H4,42,43,46)(H,48,52,53)/t29-,30+,31+,32+,34+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tuftsin-M
CAS:<p>Tuftsin-M induces respiratory can burst in peritoneal exudate cells.</p>Formula:C39H76N10O6Color and Shape:SolidMolecular weight:781.08
