CymitQuimica logo

CAS 943605-97-8

:

6-(2-fluoro-3-pyridyl)-N-methyl-pyrimidin-4-amine

Description:
6-(2-Fluoro-3-pyridyl)-N-methyl-pyrimidin-4-amine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a methyl group and a pyridyl moiety. The presence of a fluorine atom at the 2-position of the pyridyl ring contributes to its electronic properties, potentially enhancing its reactivity and interaction with biological targets. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with specific biological pathways. Its molecular structure suggests it may exhibit properties such as moderate to high solubility in organic solvents, and it may participate in hydrogen bonding due to the amine functional group. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atom, which can affect its lipophilicity and overall pharmacokinetic profile. As with many compounds in drug discovery, understanding its characteristics is crucial for evaluating its potential therapeutic applications.
Formula:C10H9FN4
InChI:InChI=1/C10H9FN4/c1-12-9-5-8(14-6-15-9)7-3-2-4-13-10(7)11/h2-6H,1H3,(H,12,14,15)
Synonyms:
  • 4-pyrimidinamine, 6-(2-fluoro-3-pyridinyl)-N-methyl-
  • 6-(2-fluoropyridin-3-yl)-N-methylpyrimidin-4-amine
  • 6-(2-Fluorpyridin-3-yl)-N-methylpyrimidin-4-amin
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.