CAS 943606-85-7

6-Methyl-5-nitro-1(2H)-isoquinolinone

Description:

6-Methyl-5-nitro-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a fused bicyclic system containing a nitrogen atom. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in organic solvents. The presence of a methyl group at the 6-position and a nitro group at the 5-position contributes to its unique reactivity and potential biological activity. The nitro group can participate in reduction reactions, making it a candidate for various synthetic applications. Additionally, isoquinolinones are known for their diverse pharmacological properties, including antimicrobial and anticancer activities. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. As with many nitro-containing compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental concerns. Overall, 6-Methyl-5-nitro-1(2H)-isoquinolinone represents a valuable compound for research in both synthetic and medicinal chemistry.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1S/C10H8N2O3/c1-6-2-3-8-7(9(6)12(14)15)4-5-11-10(8)13/h2-5H,1H3,(H,11,13)

InChI key: InChIKey=BRWDJCVVUSQDBQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(C(=O)NC=C2)=CC=C1C

Synonyms:

• 6-Methyl-5-nitro-1(2H)-isoquinolinone
• 1(2H)-Isoquinolinone, 6-methyl-5-nitro-