CAS 94367-43-8
:3-(2-hydroxy-3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-yl beta-D-glucopyranoside
Description:
3-(2-Hydroxy-3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-yl beta-D-glucopyranoside, with the CAS number 94367-43-8, is a glycoside compound characterized by its complex structure, which includes a chromen-7-yl moiety linked to a beta-D-glucopyranoside unit. This compound features multiple functional groups, including hydroxyl and methoxy groups, contributing to its potential biological activity. The presence of the glucopyranoside unit suggests that it may exhibit solubility in water and could be involved in various biochemical interactions. Its chromene structure is often associated with antioxidant properties, and compounds of this nature are frequently studied for their potential therapeutic effects, including anti-inflammatory and anticancer activities. The specific arrangement of substituents on the aromatic ring and the sugar moiety can influence its pharmacokinetics and bioactivity. Overall, this compound represents a class of natural products that may have significant implications in medicinal chemistry and pharmacology.
Formula:C23H28O10
InChI:InChI=1/C23H28O10/c1-29-15-6-5-14(18(25)22(15)30-2)12-7-11-3-4-13(8-16(11)31-10-12)32-23-21(28)20(27)19(26)17(9-24)33-23/h3-6,8,12,17,19-21,23-28H,7,9-10H2,1-2H3/t12?,17-,19-,20+,21-,23-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3R,4S,5S,6R)-2-[[3-(2-HYDROXY-3,4-DIMETHOXYPHENYL)-3,4-DIHYDRO-2H-CHROMEN-7-YL]OXY]-6-(HYDROXYMETHYL)OXANE-3,4,5-TRIOL
CAS:Formula:C23H28O10Purity:99%Molecular weight:464.4624(Iso)-Isomucronulatol 7-O-glucoside
CAS:<p>(Iso)-Isomucronulatol 7-O-glucoside</p>Purity:≥98%Molecular weight:464.46g/mol(Iso)-Isomucronulatol 7-O-glucoside
CAS:7,2′-Dihydroxy-3′,4′-dimethoxyisoflavan 7-O-β-D-glucoside (Isomucronulatol 7-O-glucoside) is a biologically active isoflavone.Cost-effective and quality-assured.Formula:C23H28O10Purity:99.61% - 99.79%Color and Shape:SolidMolecular weight:464.46Isomucronulatol 7-O-glucoside
CAS:<p>Isomucronulatol 7-O-glucoside is a flavonoid glucoside compound, which is isolated predominantly from various plant species. This compound is known for its comprehensive role as a secondary metabolite that participates in the plant's defense mechanism. The primary mode of action involves its ability to interact with biological targets at the molecular level, potentially exhibiting antioxidant, anti-inflammatory, or other bioactive properties. Isomucronulatol 7-O-glucoside may influence signaling pathways, which can alter physiological responses within organisms.</p>Purity:Min. 95%




