CymitQuimica logo

CAS 943736-62-7

:

8-Chloro-3-nitro-4-quinolinol

Description:
8-Chloro-3-nitro-4-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. The presence of a chloro group at the 8-position and a nitro group at the 3-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is often studied for its potential applications in medicinal chemistry, particularly in the development of antimicrobial or antitumor agents, due to the biological significance of quinoline derivatives. The nitro group can participate in reduction reactions, while the chloro group may serve as a site for further chemical modifications. Safety data should be consulted, as compounds with halogen and nitro substituents can pose health risks, including toxicity and environmental hazards. Overall, 8-Chloro-3-nitro-4-quinolinol is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H5ClN2O3
InChI:InChI=1S/C9H5ClN2O3/c10-6-3-1-2-5-8(6)11-4-7(9(5)13)12(14)15/h1-4H,(H,11,13)
InChI key:InChIKey=NMYGFEPIIPRFLB-UHFFFAOYSA-N
SMILES:OC=1C2=C(N=CC1N(=O)=O)C(Cl)=CC=C2
Synonyms:
  • 8-Chloro-3-nitro-4-quinolinol
  • 4-Quinolinol, 8-chloro-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.