CAS 943742-87-8

4-Bromo-β-ethylbenzeneethanol

Description:

4-Bromo-β-ethylbenzeneethanol, identified by its CAS number 943742-87-8, is an organic compound characterized by the presence of a bromine atom and an ethyl group attached to a benzene ring, along with a hydroxyl (-OH) functional group. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, which can influence its solubility, reactivity, and boiling point. The bromine substituent can enhance the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The ethyl group contributes to the hydrophobic character of the molecule, potentially affecting its interactions with other substances. In terms of applications, compounds like 4-Bromo-β-ethylbenzeneethanol may be utilized in organic synthesis, pharmaceuticals, or as intermediates in the production of more complex molecules. Safety data and handling precautions should be considered, as brominated compounds can pose health risks and environmental concerns. Overall, the unique structure of this compound allows for diverse chemical behavior and potential applications in various fields of chemistry.

Formula: C₁₀H₁₃BrO

InChI: InChI=1S/C10H13BrO/c1-2-8(7-12)9-3-5-10(11)6-4-9/h3-6,8,12H,2,7H2,1H3

InChI key: InChIKey=ANDPTZHWILNUGZ-UHFFFAOYSA-N

SMILES: C(CC)(CO)C1=CC=C(Br)C=C1

Synonyms:

• 2-(4-Bromophenyl)butan-1-ol
• Benzeneethanol, 4-bromo-β-ethyl-
• 4-Bromo-β-ethylbenzeneethanol