CAS 943752-32-7

4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-fluoro-aniline

Description:

4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-fluoro-aniline is a chemical compound characterized by its specific structural features, including a piperazine ring substituted with two methyl groups and an aniline moiety with a fluorine atom at the para position. This compound exhibits properties typical of amines, such as basicity, due to the presence of the piperazine nitrogen atoms. The fluorine substituent can influence the compound's reactivity and lipophilicity, potentially enhancing its biological activity. The stereochemistry indicated by the (3S,5R) configuration suggests that the compound may exhibit chiral properties, which can affect its interaction with biological targets. Additionally, the presence of both the piperazine and aniline functionalities may contribute to its solubility in various solvents and its potential as a pharmaceutical agent. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific biological activities.

Formula: C₁₂H₁₈FN₃

InChI: InChI=1/C12H18FN3/c1-8-6-16(7-9(2)15-8)12-4-3-10(14)5-11(12)13/h3-5,8-9,15H,6-7,14H2,1-2H3/t8-,9+

Synonyms:

• 4-[(3R,5S)-3,5-Dimethylpiperazin-1-yl]-3-fluoroaniline

4-(cis-3,5-Dimethylpiperazin-1-yl)-3-fluoroaniline

CAS: 943752-32-7

4-(cis-3,5-Dimethylpiperazin-1-yl)-3-fluoroaniline

Purity: ≥95%

Molecular weight: 223.29g/mol

Ref: 54-PC49206