CymitQuimica logo

CAS 943830-17-9

:

1-Bromo-4-chloro-2-fluoro-3-(1-methylethoxy)benzene

Description:
1-Bromo-4-chloro-2-fluoro-3-(1-methylethoxy)benzene is an organic compound characterized by its complex halogenated aromatic structure. It features a benzene ring substituted with three different halogens: bromine, chlorine, and fluorine, which contribute to its reactivity and potential applications in various chemical processes. The presence of the 1-methylethoxy group enhances its solubility and may influence its interaction with biological systems or other chemical entities. This compound is likely to exhibit properties typical of halogenated aromatics, such as increased lipophilicity and potential for electrophilic substitution reactions. Its unique combination of substituents may also impart specific characteristics, such as altered boiling and melting points compared to unsubstituted benzene derivatives. Additionally, the compound's structure suggests potential utility in fields such as pharmaceuticals, agrochemicals, or materials science, where halogenated compounds are often sought for their unique chemical properties. Safety and handling precautions should be observed due to the presence of halogens, which can pose health and environmental risks.
Formula:C9H9BrClFO
InChI:InChI=1S/C9H9BrClFO/c1-5(2)13-9-7(11)4-3-6(10)8(9)12/h3-5H,1-2H3
InChI key:InChIKey=CSUMZQJCCHOATK-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(F)C(Br)=CC=C1Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.