
CAS 943830-18-0
:1-Bromo-4-chloro-2-fluoro-3-(2-methoxyethoxy)benzene
Description:
1-Bromo-4-chloro-2-fluoro-3-(2-methoxyethoxy)benzene is an organic compound characterized by its complex halogenated aromatic structure. It features a benzene ring substituted with a bromine atom, a chlorine atom, and a fluorine atom, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the 2-methoxyethoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit properties typical of halogenated aromatics, such as increased lipophilicity and potential for electrophilic substitution reactions. Its unique combination of substituents may also impart specific characteristics, such as altered electronic properties and steric effects, which can be significant in medicinal chemistry and materials science. Additionally, the compound's CAS number, 943830-18-0, allows for easy identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, 1-Bromo-4-chloro-2-fluoro-3-(2-methoxyethoxy)benzene is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H9BrClFO2
InChI:InChI=1S/C9H9BrClFO2/c1-13-4-5-14-9-7(11)3-2-6(10)8(9)12/h2-3H,4-5H2,1H3
InChI key:InChIKey=CAXNQRXBWNIAMU-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(F)C(Br)=CC=C1Cl
Synonyms:- 1-Bromo-4-chloro-2-fluoro-3-(2-methoxyethoxy)benzene
- Benzene, 1-bromo-4-chloro-2-fluoro-3-(2-methoxyethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.