
CAS 943830-22-6
:1-Bromo-3-butoxy-4-chloro-2-fluorobenzene
Description:
1-Bromo-3-butoxy-4-chloro-2-fluorobenzene is an organic compound characterized by its complex structure, which includes a benzene ring substituted with various halogen and alkoxy groups. The presence of a bromine atom, a chlorine atom, and a fluorine atom indicates that it is a halogenated aromatic compound, which can exhibit unique reactivity and properties compared to non-halogenated analogs. The butoxy group contributes to its solubility in organic solvents and may influence its boiling and melting points. This compound may be used in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals and agrochemicals. Its specific reactivity can be attributed to the electron-withdrawing effects of the halogen substituents, which can enhance electrophilic aromatic substitution reactions. Additionally, the presence of multiple functional groups suggests potential for diverse chemical behavior, making it a subject of interest in both industrial and research settings. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C10H11BrClFO
InChI:InChI=1S/C10H11BrClFO/c1-2-3-6-14-10-8(12)5-4-7(11)9(10)13/h4-5H,2-3,6H2,1H3
InChI key:InChIKey=FENCJYANAHIEFY-UHFFFAOYSA-N
SMILES:O(CCCC)C1=C(F)C(Br)=CC=C1Cl
Synonyms:- 1-Bromo-3-butoxy-4-chloro-2-fluorobenzene
- Benzene, 1-bromo-3-butoxy-4-chloro-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.