CAS 943843-27-4

4-Pyridinemethanamine, 2-(difluoromethoxy)-, hydrochloride (1:1)

Description:

4-Pyridinemethanamine, 2-(difluoromethoxy)-, hydrochloride (1:1), with the CAS number 943843-27-4, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methanamine group attached to the pyridine, along with a difluoromethoxy substituent, indicating the presence of two fluorine atoms and a methoxy group (-OCH2F) that contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the difluoromethoxy group may influence its biological activity and pharmacokinetics, making it a subject of interest in medicinal chemistry. Additionally, the compound's hydrochloride form suggests it may exhibit specific stability and reactivity characteristics, which are important for its handling and storage. Overall, this compound's structural features suggest potential applications in drug development and research.

Formula: C₇H₈F₂N₂O·ClH

InChI: InChI=1S/C7H8F2N2O.ClH/c8-7(9)12-6-3-5(4-10)1-2-11-6;/h1-3,7H,4,10H2;1H

InChI key: InChIKey=MTOLBJHGTOQCAJ-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC(CN)=CC=N1.Cl

Synonyms:

• 4-Pyridinemethanamine, 2-(difluoromethoxy)-, hydrochloride (1:1)

(2-(Difluoromethoxy)pyridin-4-yl)methanamine hydrochloride

CAS: 943843-27-4

Formula: C₇H₉ClF₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 210.6090

Ref: IN-DA00II4E

(2-(Difluoromethoxy)pyridin-4-yl)methanamine hydrochloride

CAS: 943843-27-4

(2-(Difluoromethoxy)pyridin-4-yl)methanamine hydrochloride

Purity: 98%

Molecular weight: 210.61g/mol

Ref: 54-PC101329

(2-(Difluoromethoxy)pyridin-4-yl)methanamine hydrochloride

CAS: 943843-27-4

Purity: 98%

Molecular weight: 210.61000061035156

Ref: 10-F325745