
CAS 943843-28-5
:2-Amino-2-cyano-N-(1-methylethyl)acetamide
Description:
2-Amino-2-cyano-N-(1-methylethyl)acetamide, with the CAS number 943843-28-5, is an organic compound characterized by the presence of an amino group, a cyano group, and an acetamide moiety. This compound typically exhibits properties associated with both amines and nitriles, such as potential solubility in polar solvents due to its functional groups. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, which may influence its overall solubility and reactivity. The amino group can participate in hydrogen bonding, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the cyano group can impart unique reactivity, allowing for further derivatization. This compound may be of interest in pharmaceutical research or synthetic chemistry due to its structural features, which could lead to the development of biologically active molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C6H11N3O
InChI:InChI=1S/C6H11N3O/c1-4(2)9-6(10)5(8)3-7/h4-5H,8H2,1-2H3,(H,9,10)
InChI key:InChIKey=AHAXVIFRWMORNJ-UHFFFAOYSA-N
SMILES:C(C(C#N)N)(NC(C)C)=O
Synonyms:- Acetamide, 2-amino-2-cyano-N-(1-methylethyl)-
- 2-Amino-2-cyano-N-propan-2-ylacetamide
- 2-Amino-2-cyano-N-(1-methylethyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.