CAS 943843-63-8

2(3H)-Benzoxazolone, 6-(aminomethyl)-, hydrochloride (1:1)

Description:

2(3H)-Benzoxazolone, 6-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzoxazolone core, which features a fused benzene and oxazolone ring structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the amino group. The hydrochloride form indicates that it is a salt, which can enhance its solubility in water and influence its bioavailability. The presence of the aminomethyl group suggests potential for further functionalization, making it of interest in medicinal chemistry and drug development. This compound may exhibit biological activity, potentially serving as a scaffold for the design of pharmaceuticals. Its specific applications and interactions would depend on further studies, including its pharmacokinetics and mechanism of action. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of the hydrochloride salt, which can affect its handling properties.

Formula: C₈H₈N₂O₂·ClH

InChI: InChI=1S/C8H8N2O2.ClH/c9-4-5-1-2-6-7(3-5)12-8(11)10-6;/h1-3H,4,9H2,(H,10,11);1H

InChI key: InChIKey=FNPPJZGNLUOHOP-UHFFFAOYSA-N

SMILES: O=C1NC=2C(=CC(CN)=CC2)O1.Cl

Synonyms:

• 2(3H)-Benzoxazolone, 6-(aminomethyl)-, hydrochloride (1:1)

6-(Aminomethyl)-2,3-dihydro-1,3-benzoxazol-2-one hydrochloride

CAS: 943843-63-8

Versatile small molecule scaffold

Formula: C₈H₉ClN₂O₂

Purity: Min. 95%

Molecular weight: 200.62 g/mol

Ref: 3D-TMB84363