CAS 943845-24-7
:2-(Difluoromethoxy)-4-pyridinecarbonitrile
Description:
2-(Difluoromethoxy)-4-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a difluoromethoxy group indicates that there are two fluorine atoms attached to a methoxy group (-O-CH2F) that is further connected to the pyridine structure. Additionally, the carbonitrile functional group (-C≡N) is attached to the fourth position of the pyridine ring, contributing to the compound's reactivity and potential applications in various chemical reactions. This compound is typically used in pharmaceutical research and development due to its unique structural features, which may impart specific biological activities. Its molecular structure suggests it may exhibit polar characteristics, influencing its solubility and interaction with biological systems. As with many pyridine derivatives, it may also participate in coordination chemistry and serve as a ligand in metal complexes. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C7H4F2N2O
InChI:InChI=1S/C7H4F2N2O/c8-7(9)12-6-3-5(4-10)1-2-11-6/h1-3,7H
InChI key:InChIKey=FTAIBGRHEXLHRZ-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC(C#N)=CC=N1
Synonyms:- 4-Pyridinecarbonitrile, 2-(difluoromethoxy)-
- 2-(Difluoromethoxy)-4-pyridinecarbonitrile
- 2-(Difluoromethoxy)isonicotinonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
