CAS 94386-65-9
:Pelrinone
Description:
Pelrinone is a chemical compound classified as a selective antagonist of the muscarinic acetylcholine receptors, primarily targeting the M2 and M3 subtypes. It is often studied for its potential applications in treating various conditions related to the autonomic nervous system. The compound is characterized by its unique molecular structure, which includes specific functional groups that contribute to its pharmacological properties. Pelrinone exhibits moderate solubility in organic solvents and has a relatively low molecular weight, making it suitable for various formulations. Its mechanism of action involves inhibiting the effects of acetylcholine, leading to reduced smooth muscle contraction and secretion in target tissues. This characteristic makes Pelrinone a candidate for research in areas such as respiratory disorders and gastrointestinal motility issues. However, as with many pharmacological agents, its safety profile, efficacy, and potential side effects are subjects of ongoing research. Overall, Pelrinone represents a significant interest in medicinal chemistry and pharmacology due to its targeted action on muscarinic receptors.
Formula:C12H11N5O
InChI:InChI=1/C12H11N5O/c1-8-16-11(10(5-13)12(18)17-8)15-7-9-3-2-4-14-6-9/h2-4,6H,7H2,1H3,(H2,15,16,17,18)
SMILES:Cc1nc(c(C#N)c(n1)O)NCc1cccnc1
Synonyms:- Pelrinone [INN]
- Pelrinona
- Pelrinona [Spanish]
- Pelrinonum
- Pelrinonum [Latin]
- 5-Pyrimidinecarbonitrile, 1,4-dihydro-2-methyl-4-oxo-6-((3-pyridinylmethyl)amino)-
- 2-Methyl-4-Oxo-6-[(Pyridin-3-Ylmethyl)Amino]-1,4-Dihydropyrimidine-5-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pelrinone
CAS:Controlled ProductApplications Pelrinone is a pyrimidine derivative that is an inotropic agent.
References Bagli, J., et al.: J. Med. Chem., 31, 814 (1988);Formula:C12H11N5OColor and Shape:NeatMolecular weight:241.25Pelrinone
CAS:Pelrinone is a cardiotonic agent, which is derived from synthetic origins with the primary mode of action being the inhibition of phosphodiesterase III. This compound increases intracellular cyclic adenosine monophosphate (cAMP) levels in cardiac muscle cells, leading to enhanced calcium ion availability. The elevated calcium influx during cardiac muscle contraction results in a positive inotropic effect, which effectively improves myocardial contractility and output.Formula:C12H11N5OPurity:Min. 95%Molecular weight:241.25 g/mol

