
CAS 943962-60-5
:4-(Fluoro-18F-methyl)-N-[2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-N-2-pyridinylcyclohexanecarboxamide
Description:
The chemical substance known as "4-(Fluoro-18F-methyl)-N-[2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-N-2-pyridinylcyclohexanecarboxamide," with the CAS number 943962-60-5, is a radiolabeled compound primarily used in positron emission tomography (PET) imaging. This compound features a complex structure that includes a fluorine-18 isotope, which is crucial for its application in medical imaging due to its suitable half-life and decay properties. The presence of a piperazine moiety suggests potential interactions with neurotransmitter receptors, making it relevant in neuropharmacology. Additionally, the methoxyphenyl and pyridinyl groups contribute to its lipophilicity and receptor binding characteristics. The cyclohexanecarboxamide backbone provides structural stability and may influence the compound's pharmacokinetics. Overall, this substance is significant in the field of radiopharmaceuticals, particularly for studying neurological disorders and receptor dynamics in vivo.
Formula:C26H35FN4O2
InChI:InChI=1S/C26H35FN4O2/c1-33-24-7-3-2-6-23(24)30-17-14-29(15-18-30)16-19-31(25-8-4-5-13-28-25)26(32)22-11-9-21(20-27)10-12-22/h2-8,13,21-22H,9-12,14-20H2,1H3/i27-1
InChI key:InChIKey=BQGLPDFQLBNUGU-FMLNDMEQSA-N
SMILES:O(C)C1=C(C=CC=C1)N2CCN(CCN(C(=O)C3CCC(C[18F])CC3)C4=CC=CC=N4)CC2
Synonyms:- 4-(Fluoro-18F-methyl)-N-[2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-N-2-pyridinylcyclohexanecarboxamide
- Cyclohexanecarboxamide, 4-(fluoro-18F-methyl)-N-[2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-N-2-pyridinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mefway F-18
CAS:Mefway F-18 is a PET radioligand specific to serotonin-1A receptors.Formula:C26H35FN4O2Color and Shape:SolidMolecular weight:453.58
