CAS 943994-02-3

6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzoxazin-3-one

Description:

6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzoxazin-3-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties such as stability under ambient conditions, and it may be soluble in organic solvents due to its organic nature. The presence of the dioxaborolane group suggests potential applications in organic synthesis, particularly in cross-coupling reactions or as a reagent in various chemical transformations. Additionally, the benzoxazine structure is known for its thermal stability and potential use in polymer chemistry, particularly in the development of thermosetting resins. The compound may also exhibit interesting optical properties, making it a candidate for applications in materials science. Overall, its unique combination of functional groups and structural features positions it as a versatile compound in both synthetic and material chemistry.

Formula: C₁₄H₁₈BNO₄

InChI: InChI=1/C14H18BNO4/c1-13(2)14(3,4)20-15(19-13)9-5-6-11-10(7-9)16-12(17)8-18-11/h5-7H,8H2,1-4H3,(H,16,17)

SMILES: CC1(C)C(C)(C)OB(c2ccc3c(c2)N=C(CO3)O)O1

Synonyms:

• 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[b][1,4]oxazin-3(4H)-one

6-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-2H-Benzo[B][1,4]Oxazin-3(4H)-One

CAS: 943994-02-3

Formula: C₁₄H₁₈BNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 275.1080

Ref: IN-DA00H7KT

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 943994-02-3

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[b][1,4]oxazin-3(4H)-one

Purity: 96%

Molecular weight: 275.11g/mol

Ref: 54-OR76682

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 943994-02-3

Formula: C₁₄H₁₈BNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 275.11

Ref: 10-F233427