CAS 943994-30-7

6-acetyl-8-fluoro-4H-1,4-benzoxazin-3-one

Description:

6-Acetyl-8-fluoro-4H-1,4-benzoxazin-3-one is a synthetic organic compound characterized by its unique benzoxazine structure, which features a fused benzene and oxazine ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the acetyl and fluoro substituents contributes to its chemical reactivity and potential biological activity. The acetyl group can participate in various chemical reactions, while the fluoro atom may enhance lipophilicity and influence the compound's interaction with biological targets. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many synthetic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₀H₈FNO₃

InChI: InChI=1/C10H8FNO3/c1-5(13)6-2-7(11)10-8(3-6)12-9(14)4-15-10/h2-3H,4H2,1H3,(H,12,14)

SMILES: CC(=O)c1cc(c2c(c1)N=C(CO2)O)F

Synonyms:

• 2H-1,4-benzoxazin-3(4H)-one, 6-acetyl-8-fluoro-
• 6-Acetyl-8-fluoro-2H-1,4-benzoxazin-3(4H)-one