CAS 944-26-3

2,2'-ethane-1,2-diylbis(2-methyl-1,3-dioxolane)

Description:

2,2'-Ethane-1,2-diylbis(2-methyl-1,3-dioxolane), with the CAS number 944-26-3, is an organic compound characterized by its dioxolane functional groups. This substance features a central ethane backbone with two 2-methyl-1,3-dioxolane units attached, which contribute to its unique chemical properties. The presence of dioxolane rings indicates that the compound may exhibit properties such as good solubility in polar solvents and potential reactivity in various chemical reactions, particularly those involving nucleophiles or electrophiles. Its structure suggests that it may be used as a solvent or a reagent in organic synthesis. Additionally, the presence of multiple functional groups can influence its physical properties, such as boiling point and melting point, as well as its stability under different conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound's unique structure makes it of interest in both academic and industrial chemistry contexts.

Formula: C₁₀H₁₈O₄

InChI: InChI=1/C10H18O4/c1-9(11-5-6-12-9)3-4-10(2)13-7-8-14-10/h3-8H2,1-2H3

SMILES: CC1(CCC2(C)OCCO2)OCCO1