
CAS 944030-64-2
:6-Chloro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole
Description:
6-Chloro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a chlorine atom and a pyrrolidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its structural features. The presence of the chlorine atom may influence its reactivity and interaction with biological targets, while the pyrrolidine ring can contribute to its pharmacological properties. Compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The stereochemistry indicated by the (2S) designation suggests that the compound may exhibit chirality, which can affect its biological activity and interactions. Overall, 6-Chloro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole represents a class of compounds that are of interest in both synthetic and medicinal chemistry.
Formula:C11H12ClN3
InChI:InChI=1S/C11H12ClN3/c12-7-3-4-8-10(6-7)15-11(14-8)9-2-1-5-13-9/h3-4,6,9,13H,1-2,5H2,(H,14,15)/t9-/m0/s1
InChI key:InChIKey=WTWLSXNDPSJKCT-VIFPVBQESA-N
SMILES:ClC=1C=C2N=C(NC2=CC1)[C@@H]3CCCN3
Synonyms:- 5-Chloro-2-(S)-pyrrolidin-2-yl-1H-benzimidazole
- 1H-Benzimidazole, 6-chloro-2-[(2S)-2-pyrrolidinyl]-
- 6-Chloro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole
- (s)-6-Chloro-2-pyrrolidin-2-yl-1H-benzoimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.