
CAS 944030-65-3
:5,6-Difluoro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole
Description:
5,6-Difluoro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with two fluorine atoms at the 5 and 6 positions and a pyrrolidine moiety at the 2 position. This compound is notable for its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, making it an interesting candidate for drug development. The pyrrolidine group contributes to the compound's stereochemistry, which can influence its interaction with biological targets. Additionally, the benzimidazole framework is known for its role in various therapeutic applications, including anti-cancer and anti-parasitic activities. Overall, 5,6-Difluoro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole represents a class of compounds that may exhibit significant pharmacological potential due to its structural characteristics and functional groups.
Formula:C11H11F2N3
InChI:InChI=1S/C11H11F2N3/c12-6-4-9-10(5-7(6)13)16-11(15-9)8-2-1-3-14-8/h4-5,8,14H,1-3H2,(H,15,16)/t8-/m0/s1
InChI key:InChIKey=ASWJREVRPRDELF-QMMMGPOBSA-N
SMILES:FC=1C=C2C(N=C(N2)[C@@H]3CCCN3)=CC1F
Synonyms:- 5,6-Difluoro-2-(S)-pyrrolidin-2-yl-1H-benzimidazole
- (s)-5,6-Difluoro-2-pyrrolidin-2-yl-1H-benzoimidazole
- 5,6-Difluoro-2-[(2S)-2-pyrrolidinyl]-1H-benzimidazole
- 1H-Benzimidazole, 5,6-difluoro-2-[(2S)-2-pyrrolidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.